C20H14ClN3O6 — CID 126090958
2-(1,3-benzodioxol-5-yl)-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 126090958) has the molecular formula C20H14ClN3O6 and a molecular weight of 427.80 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126090958 |
| Molecular Formula | C20H14ClN3O6 |
| Molecular Weight | 427.80 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N/N=C\c1ccc(-c2cc([N+](=O)[O-])ccc2Cl)o1 |
| InChI | InChI=1S/C20H14ClN3O6/c21-16-4-2-13(24(26)27)9-15(16)17-6-3-14(30-17)10-22-23-20(25)8-12-1-5-18-19(7-12)29-11-28-18/h1-7,9-10H,8,11H2,(H,23,25)/b22-10- |
| InChIKey | MJLBFZVCKSRQLD-YVNNLAQVSA-N |
| XLogP | 3.93 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.80 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|