C20H14BrN3O6 — CID 1275206
2-(1,3-benzodioxol-5-yl)-N-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 1275206) has the molecular formula C20H14BrN3O6 and a molecular weight of 472.25 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 1275206 |
| Molecular Formula | C20H14BrN3O6 |
| Molecular Weight | 472.25 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)NN=Cc1ccc(-c2ccc([N+](=O)[O-])cc2Br)o1 |
| InChI | InChI=1S/C20H14BrN3O6/c21-16-9-13(24(26)27)2-4-15(16)17-6-3-14(30-17)10-22-23-20(25)8-12-1-5-18-19(7-12)29-11-28-18/h1-7,9-10H,8,11H2,(H,23,25) |
| InChIKey | RRDQWJMZKNLJBV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.25 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|