C22H17BrN4O — CID 1268464
1-[(3-bromophenyl)methyl]-N-(naphthalen-1-ylmethylideneamino)pyrazole-3-carboxamide (PubChem CID 1268464) has the molecular formula C22H17BrN4O and a molecular weight of 433.31 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-N-(naphthalen-1-ylmethylideneamino)pyrazole-3-carboxamide.
| Compound Name | 1-[(3-bromophenyl)methyl]-N-(naphthalen-1-ylmethylideneamino)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 1268464 |
| Molecular Formula | C22H17BrN4O |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-N-(naphthalen-1-ylmethylideneamino)pyrazole-3-carboxamide |
| SMILES | O=C(NN=Cc1cccc2ccccc12)c1ccn(Cc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C22H17BrN4O/c23-19-9-3-5-16(13-19)15-27-12-11-21(26-27)22(28)25-24-14-18-8-4-7-17-6-1-2-10-20(17)18/h1-14H,15H2,(H,25,28) |
| InChIKey | JBCKEZZGJBBIER-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|