C21H15Cl2N5O — CID 4145229
1-[(4-chlorophenyl)methyl]-N-[(2-chloroquinolin-3-yl)methylideneamino]pyrazole-3-carboxamide (PubChem CID 4145229) has the molecular formula C21H15Cl2N5O and a molecular weight of 424.29 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-[(2-chloroquinolin-3-yl)methylideneamino]pyrazole-3-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-[(2-chloroquinolin-3-yl)methylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4145229 |
| Molecular Formula | C21H15Cl2N5O |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-[(2-chloroquinolin-3-yl)methylideneamino]pyrazole-3-carboxamide |
| SMILES | O=C(NN=Cc1cc2ccccc2nc1Cl)c1ccn(Cc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C21H15Cl2N5O/c22-17-7-5-14(6-8-17)13-28-10-9-19(27-28)21(29)26-24-12-16-11-15-3-1-2-4-18(15)25-20(16)23/h1-12H,13H2,(H,26,29) |
| InChIKey | WDVHYMMNJKLKIC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|