C18H13Cl2N5O4 — CID 136858172
N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide (PubChem CID 136858172) has the molecular formula C18H13Cl2N5O4 and a molecular weight of 434.24 g/mol. Its IUPAC name is N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 136858172 |
| Molecular Formula | C18H13Cl2N5O4 |
| Molecular Weight | 434.24 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(N/N=C\c1cc(Cl)cc(Cl)c1O)c1ccn(Cc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C18H13Cl2N5O4/c19-13-7-12(17(26)15(20)8-13)9-21-22-18(27)16-5-6-24(23-16)10-11-1-3-14(4-2-11)25(28)29/h1-9,26H,10H2,(H,22,27)/b21-9- |
| InChIKey | PVXYZHWPVVGQKH-NKVSQWTQSA-N |
| XLogP | 3.62 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.24 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|