C18H14Cl2N4O2 — CID 136858110
N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(pyrazol-1-ylmethyl)benzamide (PubChem CID 136858110) has the molecular formula C18H14Cl2N4O2 and a molecular weight of 389.24 g/mol. Its IUPAC name is N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(pyrazol-1-ylmethyl)benzamide.
| Compound Name | N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(pyrazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 136858110 |
| Molecular Formula | C18H14Cl2N4O2 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(pyrazol-1-ylmethyl)benzamide |
| SMILES | O=C(N/N=C\c1cc(Cl)cc(Cl)c1O)c1cccc(Cn2cccn2)c1 |
| InChI | InChI=1S/C18H14Cl2N4O2/c19-15-8-14(17(25)16(20)9-15)10-21-23-18(26)13-4-1-3-12(7-13)11-24-6-2-5-22-24/h1-10,25H,11H2,(H,23,26)/b21-10- |
| InChIKey | HLIYEJAJVMCYJQ-FBHDLOMBSA-N |
| XLogP | 3.71 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|