C18H15N6O6- — CID 137215945
4-(dihydroxyamino)-2-nitro-6-[(E)-[[3-(pyrazol-1-ylmethyl)benzoyl]hydrazinylidene]methyl]phenolate (PubChem CID 137215945) has the molecular formula C18H15N6O6- and a molecular weight of 411.35 g/mol. Its IUPAC name is 4-(dihydroxyamino)-2-nitro-6-[(E)-[[3-(pyrazol-1-ylmethyl)benzoyl]hydrazinylidene]methyl]phenolate.
| Compound Name | 4-(dihydroxyamino)-2-nitro-6-[(E)-[[3-(pyrazol-1-ylmethyl)benzoyl]hydrazinylidene]methyl]phenolate |
|---|---|
| PubChem CID | 137215945 |
| Molecular Formula | C18H15N6O6- |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 4-(dihydroxyamino)-2-nitro-6-[(E)-[[3-(pyrazol-1-ylmethyl)benzoyl]hydrazinylidene]methyl]phenolate |
| SMILES | O=C(N/N=C/c1cc(N(O)O)cc([N+](=O)[O-])c1[O-])c1cccc(Cn2cccn2)c1 |
| InChI | InChI=1S/C18H16N6O6/c25-17-14(8-15(23(27)28)9-16(17)24(29)30)10-19-21-18(26)13-4-1-3-12(7-13)11-22-6-2-5-20-22/h1-10,25,27-28H,11H2,(H,21,26)/p-1/b19-10+ |
| InChIKey | YTCRJGSCOKSMTD-VXLYETTFSA-M |
| XLogP | 1.26 |
| TPSA | 169.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|