C20H14Cl2N2O3 — CID 137167158
N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-phenoxybenzamide (PubChem CID 137167158) has the molecular formula C20H14Cl2N2O3 and a molecular weight of 401.25 g/mol. Its IUPAC name is N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-phenoxybenzamide.
| Compound Name | N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-phenoxybenzamide |
|---|---|
| PubChem CID | 137167158 |
| Molecular Formula | C20H14Cl2N2O3 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-phenoxybenzamide |
| SMILES | O=C(NN=Cc1cc(Cl)cc(Cl)c1O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H14Cl2N2O3/c21-15-9-14(19(25)18(22)11-15)12-23-24-20(26)13-5-4-8-17(10-13)27-16-6-2-1-3-7-16/h1-12,25H,(H,24,26) |
| InChIKey | VQJYPUWNEIGBGM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|