C14H12Cl2N3O2+ — CID 136680564
N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylpyridin-1-ium-4-carboxamide (PubChem CID 136680564) has the molecular formula C14H12Cl2N3O2+ and a molecular weight of 325.18 g/mol. Its IUPAC name is N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylpyridin-1-ium-4-carboxamide.
| Compound Name | N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylpyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 136680564 |
| Molecular Formula | C14H12Cl2N3O2+ |
| Molecular Weight | 325.18 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-1-methylpyridin-1-ium-4-carboxamide |
| SMILES | C[n+]1ccc(C(=O)NN=Cc2cc(Cl)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C14H11Cl2N3O2/c1-19-4-2-9(3-5-19)14(21)18-17-8-10-6-11(15)7-12(16)13(10)20/h2-8,21H,1H3/p+1 |
| InChIKey | SSTLNZAIXMDGHU-UHFFFAOYSA-O |
| XLogP | 2.29 |
| TPSA | 65.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.18 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|