C15H11BrCl2N2O2 — CID 5196693
3-bromo-N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4-methylbenzamide (PubChem CID 5196693) has the molecular formula C15H11BrCl2N2O2 and a molecular weight of 402.08 g/mol. Its IUPAC name is 3-bromo-N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4-methylbenzamide.
| Compound Name | 3-bromo-N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 5196693 |
| Molecular Formula | C15H11BrCl2N2O2 |
| Molecular Weight | 402.08 g/mol |
| Exact Mass | 399.94 |
| IUPAC Name | 3-bromo-N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NN=Cc2cc(Cl)cc(Cl)c2O)cc1Br |
| InChI | InChI=1S/C15H11BrCl2N2O2/c1-8-2-3-9(5-12(8)16)15(22)20-19-7-10-4-11(17)6-13(18)14(10)21/h2-7,21H,1H3,(H,20,22) |
| InChIKey | CHDZYMWWUOCQHF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.08 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|