C15H10Cl2N4O6 — CID 137118534
N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-(2,4-dinitrophenyl)acetamide (PubChem CID 137118534) has the molecular formula C15H10Cl2N4O6 and a molecular weight of 413.17 g/mol. Its IUPAC name is N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-(2,4-dinitrophenyl)acetamide.
| Compound Name | N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-(2,4-dinitrophenyl)acetamide |
|---|---|
| PubChem CID | 137118534 |
| Molecular Formula | C15H10Cl2N4O6 |
| Molecular Weight | 413.17 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-(2,4-dinitrophenyl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])N/N=C\c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C15H10Cl2N4O6/c16-10-3-9(15(23)12(17)5-10)7-18-19-14(22)4-8-1-2-11(20(24)25)6-13(8)21(26)27/h1-3,5-7,23H,4H2,(H,19,22)/b18-7- |
| InChIKey | IQOOOOPCCQYNRP-WSVATBPTSA-N |
| XLogP | 3.21 |
| TPSA | 147.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.17 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|