C15H12ClN3O3 — CID 4291716
N-[(2-chlorophenyl)methylideneamino]-2-(2-nitrophenyl)acetamide (PubChem CID 4291716) has the molecular formula C15H12ClN3O3 and a molecular weight of 317.73 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methylideneamino]-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[(2-chlorophenyl)methylideneamino]-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 4291716 |
| Molecular Formula | C15H12ClN3O3 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-[(2-chlorophenyl)methylideneamino]-2-(2-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])NN=Cc1ccccc1Cl |
| InChI | InChI=1S/C15H12ClN3O3/c16-13-7-3-1-6-12(13)10-17-18-15(20)9-11-5-2-4-8-14(11)19(21)22/h1-8,10H,9H2,(H,18,20) |
| InChIKey | JOPVMWLZPANWKI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|