C22H18N4O6 — CID 3403586
2-(2-nitrophenyl)-N-[[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 3403586) has the molecular formula C22H18N4O6 and a molecular weight of 434.41 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-N-[[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-nitrophenyl)-N-[[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 3403586 |
| Molecular Formula | C22H18N4O6 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-(2-nitrophenyl)-N-[[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])NN=Cc1ccccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H18N4O6/c27-22(13-17-5-1-3-7-20(17)26(30)31)24-23-14-18-6-2-4-8-21(18)32-15-16-9-11-19(12-10-16)25(28)29/h1-12,14H,13,15H2,(H,24,27) |
| InChIKey | NBYQJDCDIBVHOK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|