C17H16N8O4 — CID 6863094
2-(5-aminotetrazol-1-yl)-N-[(E)-[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 6863094) has the molecular formula C17H16N8O4 and a molecular weight of 396.37 g/mol. Its IUPAC name is 2-(5-aminotetrazol-1-yl)-N-[(E)-[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(5-aminotetrazol-1-yl)-N-[(E)-[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6863094 |
| Molecular Formula | C17H16N8O4 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-(5-aminotetrazol-1-yl)-N-[(E)-[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | Nc1nnnn1CC(=O)N/N=C/c1ccccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H16N8O4/c18-17-21-22-23-24(17)10-16(26)20-19-9-13-3-1-2-4-15(13)29-11-12-5-7-14(8-6-12)25(27)28/h1-9H,10-11H2,(H,20,26)(H2,18,21,23)/b19-9+ |
| InChIKey | NZXYUWOMCLJVDJ-DJKKODMXSA-N |
| XLogP | 0.89 |
| TPSA | 163.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|