C24H23N3O4 — CID 99944529
2-(2,4-dimethylphenyl)-N-[(E)-[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 99944529) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-N-[(E)-[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2,4-dimethylphenyl)-N-[(E)-[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 99944529 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-N-[(E)-[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(CC(=O)N/N=C/c2ccccc2OCc2ccc([N+](=O)[O-])cc2)c(C)c1 |
| InChI | InChI=1S/C24H23N3O4/c1-17-7-10-20(18(2)13-17)14-24(28)26-25-15-21-5-3-4-6-23(21)31-16-19-8-11-22(12-9-19)27(29)30/h3-13,15H,14,16H2,1-2H3,(H,26,28)/b25-15+ |
| InChIKey | AXTSTRBYXPFHLF-MFKUBSTISA-N |
| XLogP | 4.48 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|