C22H16Cl3N3O4 — CID 3955282
N-[[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide (PubChem CID 3955282) has the molecular formula C22H16Cl3N3O4 and a molecular weight of 492.75 g/mol. Its IUPAC name is N-[[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3955282 |
| Molecular Formula | C22H16Cl3N3O4 |
| Molecular Weight | 492.75 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | N-[[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])NN=Cc1cc(Cl)c(OCc2ccccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H16Cl3N3O4/c23-17-7-3-1-6-16(17)13-32-22-18(24)9-14(10-19(22)25)12-26-27-21(29)11-15-5-2-4-8-20(15)28(30)31/h1-10,12H,11,13H2,(H,27,29) |
| InChIKey | FUIUUOUGSWUYTQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.75 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|