C23H16Cl2N4O4 — CID 124552236
N-[(E)-[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide (PubChem CID 124552236) has the molecular formula C23H16Cl2N4O4 and a molecular weight of 483.31 g/mol. Its IUPAC name is N-[(E)-[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[(E)-[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 124552236 |
| Molecular Formula | C23H16Cl2N4O4 |
| Molecular Weight | 483.31 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | N-[(E)-[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide |
| SMILES | N#Cc1ccccc1COc1c(Cl)cc(/C=N/NC(=O)Cc2ccccc2[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C23H16Cl2N4O4/c24-19-9-15(10-20(25)23(19)33-14-18-7-2-1-6-17(18)12-26)13-27-28-22(30)11-16-5-3-4-8-21(16)29(31)32/h1-10,13H,11,14H2,(H,28,30)/b27-13+ |
| InChIKey | AOXGTTAPLHDGIX-UVHMKAGCSA-N |
| XLogP | 5.05 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.31 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|