C22H16Cl2N4O6 — CID 126378521
N-[(E)-[3,5-dichloro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide (PubChem CID 126378521) has the molecular formula C22H16Cl2N4O6 and a molecular weight of 503.30 g/mol. Its IUPAC name is N-[(E)-[3,5-dichloro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[(E)-[3,5-dichloro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126378521 |
| Molecular Formula | C22H16Cl2N4O6 |
| Molecular Weight | 503.30 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | N-[(E)-[3,5-dichloro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])N/N=C/c1cc(Cl)c(OCc2cccc([N+](=O)[O-])c2)c(Cl)c1 |
| InChI | InChI=1S/C22H16Cl2N4O6/c23-18-9-15(12-25-26-21(29)11-16-5-1-2-7-20(16)28(32)33)10-19(24)22(18)34-13-14-4-3-6-17(8-14)27(30)31/h1-10,12H,11,13H2,(H,26,29)/b25-12+ |
| InChIKey | WWXOLBSZLIOJRU-BRJLIKDPSA-N |
| XLogP | 5.08 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.30 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|