C16H13BrClN3O4 — CID 124549000
N-[(E)-(3-bromo-5-chloro-4-methoxyphenyl)methylideneamino]-2-(2-nitrophenyl)acetamide (PubChem CID 124549000) has the molecular formula C16H13BrClN3O4 and a molecular weight of 426.65 g/mol. Its IUPAC name is N-[(E)-(3-bromo-5-chloro-4-methoxyphenyl)methylideneamino]-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[(E)-(3-bromo-5-chloro-4-methoxyphenyl)methylideneamino]-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 124549000 |
| Molecular Formula | C16H13BrClN3O4 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 424.98 |
| IUPAC Name | N-[(E)-(3-bromo-5-chloro-4-methoxyphenyl)methylideneamino]-2-(2-nitrophenyl)acetamide |
| SMILES | COc1c(Cl)cc(/C=N/NC(=O)Cc2ccccc2[N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C16H13BrClN3O4/c1-25-16-12(17)6-10(7-13(16)18)9-19-20-15(22)8-11-4-2-3-5-14(11)21(23)24/h2-7,9H,8H2,1H3,(H,20,22)/b19-9+ |
| InChIKey | AXWTZNHUZQHAHU-DJKKODMXSA-N |
| XLogP | 3.71 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|