C14H8Cl3N3O5 — CID 4628926
2-(2,4-dinitrophenyl)-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 4628926) has the molecular formula C14H8Cl3N3O5 and a molecular weight of 404.59 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-(2,4-dinitrophenyl)-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 4628926 |
| Molecular Formula | C14H8Cl3N3O5 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 402.95 |
| IUPAC Name | 2-(2,4-dinitrophenyl)-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H8Cl3N3O5/c15-9-5-11(17)12(6-10(9)16)18-14(21)3-7-1-2-8(19(22)23)4-13(7)20(24)25/h1-2,4-6H,3H2,(H,18,21) |
| InChIKey | HOPHFOCORGGMCG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|