C15H13N3O6 — CID 4629043
2-(2,4-dinitrophenyl)-N-(4-methoxyphenyl)acetamide (PubChem CID 4629043) has the molecular formula C15H13N3O6 and a molecular weight of 331.28 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-(2,4-dinitrophenyl)-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4629043 |
| Molecular Formula | C15H13N3O6 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-(2,4-dinitrophenyl)-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H13N3O6/c1-24-13-6-3-11(4-7-13)16-15(19)8-10-2-5-12(17(20)21)9-14(10)18(22)23/h2-7,9H,8H2,1H3,(H,16,19) |
| InChIKey | XZEDSTQGAVOPFX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|