C13H10N4O5 — CID 4631764
2-(2,4-dinitrophenyl)-N-pyridin-3-ylacetamide (PubChem CID 4631764) has the molecular formula C13H10N4O5 and a molecular weight of 302.25 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-N-pyridin-3-ylacetamide.
| Compound Name | 2-(2,4-dinitrophenyl)-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 4631764 |
| Molecular Formula | C13H10N4O5 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-(2,4-dinitrophenyl)-N-pyridin-3-ylacetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])Nc1cccnc1 |
| InChI | InChI=1S/C13H10N4O5/c18-13(15-10-2-1-5-14-8-10)6-9-3-4-11(16(19)20)7-12(9)17(21)22/h1-5,7-8H,6H2,(H,15,18) |
| InChIKey | HDMXGEVDGJMBCC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|