C20H16N4O4 — CID 39678604
N-[3-[[2-(2-nitrophenyl)acetyl]amino]phenyl]pyridine-3-carboxamide (PubChem CID 39678604) has the molecular formula C20H16N4O4 and a molecular weight of 376.37 g/mol. Its IUPAC name is N-[3-[[2-(2-nitrophenyl)acetyl]amino]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[[2-(2-nitrophenyl)acetyl]amino]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 39678604 |
| Molecular Formula | C20H16N4O4 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[3-[[2-(2-nitrophenyl)acetyl]amino]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])Nc1cccc(NC(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C20H16N4O4/c25-19(11-14-5-1-2-9-18(14)24(27)28)22-16-7-3-8-17(12-16)23-20(26)15-6-4-10-21-13-15/h1-10,12-13H,11H2,(H,22,25)(H,23,26) |
| InChIKey | QWAURVBDQVRFIX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|