C23H19N3O3 — CID 39678884
N-[3-[[2-(6-methyl-1-benzofuran-3-yl)acetyl]amino]phenyl]pyridine-3-carboxamide (PubChem CID 39678884) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-[3-[[2-(6-methyl-1-benzofuran-3-yl)acetyl]amino]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[[2-(6-methyl-1-benzofuran-3-yl)acetyl]amino]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 39678884 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-[3-[[2-(6-methyl-1-benzofuran-3-yl)acetyl]amino]phenyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc2c(CC(=O)Nc3cccc(NC(=O)c4cccnc4)c3)coc2c1 |
| InChI | InChI=1S/C23H19N3O3/c1-15-7-8-20-17(14-29-21(20)10-15)11-22(27)25-18-5-2-6-19(12-18)26-23(28)16-4-3-9-24-13-16/h2-10,12-14H,11H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | NHVGBTCHMWSWGB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |