C18H20N4O5 — CID 2658350
N-(4-methoxyphenyl)-2-[methyl-[2-(3-nitroanilino)-2-oxoethyl]amino]acetamide (PubChem CID 2658350) has the molecular formula C18H20N4O5 and a molecular weight of 372.38 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[methyl-[2-(3-nitroanilino)-2-oxoethyl]amino]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[methyl-[2-(3-nitroanilino)-2-oxoethyl]amino]acetamide |
|---|---|
| PubChem CID | 2658350 |
| Molecular Formula | C18H20N4O5 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[methyl-[2-(3-nitroanilino)-2-oxoethyl]amino]acetamide |
| SMILES | COc1ccc(NC(=O)CN(C)CC(=O)Nc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H20N4O5/c1-21(11-17(23)19-13-6-8-16(27-2)9-7-13)12-18(24)20-14-4-3-5-15(10-14)22(25)26/h3-10H,11-12H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | OHTNFKQWLUNWII-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|