C24H23N5O7 — CID 3933915
2-[(4-methoxyphenyl)methyl-[2-(3-nitroanilino)-2-oxoethyl]amino]-N-(3-nitrophenyl)acetamide (PubChem CID 3933915) has the molecular formula C24H23N5O7 and a molecular weight of 493.48 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl-[2-(3-nitroanilino)-2-oxoethyl]amino]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[(4-methoxyphenyl)methyl-[2-(3-nitroanilino)-2-oxoethyl]amino]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3933915 |
| Molecular Formula | C24H23N5O7 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl-[2-(3-nitroanilino)-2-oxoethyl]amino]-N-(3-nitrophenyl)acetamide |
| SMILES | COc1ccc(CN(CC(=O)Nc2cccc([N+](=O)[O-])c2)CC(=O)Nc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H23N5O7/c1-36-22-10-8-17(9-11-22)14-27(15-23(30)25-18-4-2-6-20(12-18)28(32)33)16-24(31)26-19-5-3-7-21(13-19)29(34)35/h2-13H,14-16H2,1H3,(H,25,30)(H,26,31) |
| InChIKey | DXLJITIPUQWMRE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 156.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|