C16H11Cl4N3O4 — CID 20562807
N-[(3-chloro-4-nitrophenyl)methyl]-N'-(2,4,5-trichlorophenyl)propanediamide (PubChem CID 20562807) has the molecular formula C16H11Cl4N3O4 and a molecular weight of 451.09 g/mol. Its IUPAC name is N-[(3-chloro-4-nitrophenyl)methyl]-N'-(2,4,5-trichlorophenyl)propanediamide.
| Compound Name | N-[(3-chloro-4-nitrophenyl)methyl]-N'-(2,4,5-trichlorophenyl)propanediamide |
|---|---|
| PubChem CID | 20562807 |
| Molecular Formula | C16H11Cl4N3O4 |
| Molecular Weight | 451.09 g/mol |
| Exact Mass | 448.95 |
| IUPAC Name | N-[(3-chloro-4-nitrophenyl)methyl]-N'-(2,4,5-trichlorophenyl)propanediamide |
| SMILES | O=C(CC(=O)Nc1cc(Cl)c(Cl)cc1Cl)NCc1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl4N3O4/c17-9-4-11(19)13(5-10(9)18)22-16(25)6-15(24)21-7-8-1-2-14(23(26)27)12(20)3-8/h1-5H,6-7H2,(H,21,24)(H,22,25) |
| InChIKey | PSPXGEQRQYQDMR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.09 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|