C8H5ClF3NO2 — CID 151045899
2-chloro-1-nitro-4-(2,2,2-trifluoroethyl)benzene (PubChem CID 151045899) has the molecular formula C8H5ClF3NO2 and a molecular weight of 239.58 g/mol. Its IUPAC name is 2-chloro-1-nitro-4-(2,2,2-trifluoroethyl)benzene.
| Compound Name | 2-chloro-1-nitro-4-(2,2,2-trifluoroethyl)benzene |
|---|---|
| PubChem CID | 151045899 |
| Molecular Formula | C8H5ClF3NO2 |
| Molecular Weight | 239.58 g/mol |
| Exact Mass | 239.00 |
| IUPAC Name | 2-chloro-1-nitro-4-(2,2,2-trifluoroethyl)benzene |
| SMILES | O=[N+]([O-])c1ccc(CC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C8H5ClF3NO2/c9-6-3-5(4-8(10,11)12)1-2-7(6)13(14)15/h1-3H,4H2 |
| InChIKey | MDBOECUQLFICQG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|