C15H10ClF3NNaO5 — CID 173313725
sodium;5-[2-chloro-4-(2,2,2-trifluoroethyl)phenoxy]-2-nitrobenzoic acid;hydride (PubChem CID 173313725) has the molecular formula C15H10ClF3NNaO5 and a molecular weight of 399.68 g/mol. Its IUPAC name is sodium;5-[2-chloro-4-(2,2,2-trifluoroethyl)phenoxy]-2-nitrobenzoic acid;hydride.
| Compound Name | sodium;5-[2-chloro-4-(2,2,2-trifluoroethyl)phenoxy]-2-nitrobenzoic acid;hydride |
|---|---|
| PubChem CID | 173313725 |
| Molecular Formula | C15H10ClF3NNaO5 |
| Molecular Weight | 399.68 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | sodium;5-[2-chloro-4-(2,2,2-trifluoroethyl)phenoxy]-2-nitrobenzoic acid;hydride |
| SMILES | O=C(O)c1cc(Oc2ccc(CC(F)(F)F)cc2Cl)ccc1[N+](=O)[O-].[H-].[Na+] |
| InChI | InChI=1S/C15H9ClF3NO5.Na.H/c16-11-5-8(7-15(17,18)19)1-4-13(11)25-9-2-3-12(20(23)24)10(6-9)14(21)22;;/h1-6H,7H2,(H,21,22);;/q;+1;-1 |
| InChIKey | ZIGNDDLIVVURPF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.68 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|