C16H11ClF3KNO5+ — CID 70354724
potassium 1-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-2-methoxyethanone (PubChem CID 70354724) has the molecular formula C16H11ClF3KNO5+ and a molecular weight of 428.81 g/mol. Its IUPAC name is potassium 1-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-2-methoxyethanone.
| Compound Name | potassium 1-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-2-methoxyethanone |
|---|---|
| PubChem CID | 70354724 |
| Molecular Formula | C16H11ClF3KNO5+ |
| Molecular Weight | 428.81 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | potassium 1-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-2-methoxyethanone |
| SMILES | COCC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-].[K+] |
| InChI | InChI=1S/C16H11ClF3NO5.K/c1-25-8-14(22)11-7-10(3-4-13(11)21(23)24)26-15-5-2-9(6-12(15)17)16(18,19)20;/h2-7H,8H2,1H3;/q;+1 |
| InChIKey | WMXRXZCCKWFZHA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.81 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|