C16H14ClF3N2O5 — CID 12960256
5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid;N-methylmethanamine (PubChem CID 12960256) has the molecular formula C16H14ClF3N2O5 and a molecular weight of 406.74 g/mol. Its IUPAC name is 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid;N-methylmethanamine.
| Compound Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid;N-methylmethanamine |
|---|---|
| PubChem CID | 12960256 |
| Molecular Formula | C16H14ClF3N2O5 |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid;N-methylmethanamine |
| SMILES | CNC.O=C(O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H7ClF3NO5.C2H7N/c15-10-5-7(14(16,17)18)1-4-12(10)24-8-2-3-11(19(22)23)9(6-8)13(20)21;1-3-2/h1-6H,(H,20,21);3H,1-2H3 |
| InChIKey | RLVRJXCRXLEOLD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|