C21H10ClF3I2N2O6 — CID 70135487
5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid;4-hydroxy-3,5-diiodobenzonitrile (PubChem CID 70135487) has the molecular formula C21H10ClF3I2N2O6 and a molecular weight of 732.57 g/mol. Its IUPAC name is 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid;4-hydroxy-3,5-diiodobenzonitrile.
| Compound Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid;4-hydroxy-3,5-diiodobenzonitrile |
|---|---|
| PubChem CID | 70135487 |
| Molecular Formula | C21H10ClF3I2N2O6 |
| Molecular Weight | 732.57 g/mol |
| Exact Mass | 731.83 |
| IUPAC Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid;4-hydroxy-3,5-diiodobenzonitrile |
| SMILES | N#Cc1cc(I)c(O)c(I)c1.O=C(O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H7ClF3NO5.C7H3I2NO/c15-10-5-7(14(16,17)18)1-4-12(10)24-8-2-3-11(19(22)23)9(6-8)13(20)21;8-5-1-4(3-10)2-6(9)7(5)11/h1-6H,(H,20,21);1-2,11H |
| InChIKey | GRFNOKUKNLAUMF-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 133.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.57 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|