C16H11ClF3NO3 — CID 14255807
2-chloro-1-(4-nitro-3-prop-1-en-2-ylphenoxy)-4-(trifluoromethyl)benzene (PubChem CID 14255807) has the molecular formula C16H11ClF3NO3 and a molecular weight of 357.72 g/mol. Its IUPAC name is 2-chloro-1-(4-nitro-3-prop-1-en-2-ylphenoxy)-4-(trifluoromethyl)benzene.
| Compound Name | 2-chloro-1-(4-nitro-3-prop-1-en-2-ylphenoxy)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 14255807 |
| Molecular Formula | C16H11ClF3NO3 |
| Molecular Weight | 357.72 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 2-chloro-1-(4-nitro-3-prop-1-en-2-ylphenoxy)-4-(trifluoromethyl)benzene |
| SMILES | C=C(C)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H11ClF3NO3/c1-9(2)12-8-11(4-5-14(12)21(22)23)24-15-6-3-10(7-13(15)17)16(18,19)20/h3-8H,1H2,2H3 |
| InChIKey | DJBLICNFBFIFEA-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.72 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|