C14H9Cl2F3N2O3S — CID 134122420
5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzenecarbothioamide;hydrochloride (PubChem CID 134122420) has the molecular formula C14H9Cl2F3N2O3S and a molecular weight of 413.20 g/mol. Its IUPAC name is 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzenecarbothioamide;hydrochloride.
| Compound Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzenecarbothioamide;hydrochloride |
|---|---|
| PubChem CID | 134122420 |
| Molecular Formula | C14H9Cl2F3N2O3S |
| Molecular Weight | 413.20 g/mol |
| Exact Mass | 411.97 |
| IUPAC Name | 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzenecarbothioamide;hydrochloride |
| SMILES | Cl.NC(=S)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H8ClF3N2O3S.ClH/c15-10-5-7(14(16,17)18)1-4-12(10)23-8-2-3-11(20(21)22)9(6-8)13(19)24;/h1-6H,(H2,19,24);1H |
| InChIKey | GREQBAIDPOVHBF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.20 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|