C14H8F4N2O4 — CID 57174835
5-[2-fluoro-4-(trifluoromethyl)phenoxy]-2-nitrobenzamide (PubChem CID 57174835) has the molecular formula C14H8F4N2O4 and a molecular weight of 344.22 g/mol. Its IUPAC name is 5-[2-fluoro-4-(trifluoromethyl)phenoxy]-2-nitrobenzamide.
| Compound Name | 5-[2-fluoro-4-(trifluoromethyl)phenoxy]-2-nitrobenzamide |
|---|---|
| PubChem CID | 57174835 |
| Molecular Formula | C14H8F4N2O4 |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 5-[2-fluoro-4-(trifluoromethyl)phenoxy]-2-nitrobenzamide |
| SMILES | NC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H8F4N2O4/c15-10-5-7(14(16,17)18)1-4-12(10)24-8-2-3-11(20(22)23)9(6-8)13(19)21/h1-6H,(H2,19,21) |
| InChIKey | VXXJXNFYSQTXHH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|