C17H13F3N4O7 — CID 88666154
methyl N-(methylcarbamoyl)-2-nitro-5-[2-nitro-4-(trifluoromethyl)phenoxy]benzenecarboximidate (PubChem CID 88666154) has the molecular formula C17H13F3N4O7 and a molecular weight of 442.31 g/mol. Its IUPAC name is methyl N-(methylcarbamoyl)-2-nitro-5-[2-nitro-4-(trifluoromethyl)phenoxy]benzenecarboximidate.
| Compound Name | methyl N-(methylcarbamoyl)-2-nitro-5-[2-nitro-4-(trifluoromethyl)phenoxy]benzenecarboximidate |
|---|---|
| PubChem CID | 88666154 |
| Molecular Formula | C17H13F3N4O7 |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | methyl N-(methylcarbamoyl)-2-nitro-5-[2-nitro-4-(trifluoromethyl)phenoxy]benzenecarboximidate |
| SMILES | CNC(=O)N=C(OC)c1cc(Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13F3N4O7/c1-21-16(25)22-15(30-2)11-8-10(4-5-12(11)23(26)27)31-14-6-3-9(17(18,19)20)7-13(14)24(28)29/h3-8H,1-2H3,(H,21,25) |
| InChIKey | ATZBCRIOQKYBSP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|