C18H13F3N4O5 — CID 70440781
methyl 5-[2-cyano-4-(trifluoromethyl)phenoxy]-N-(methylcarbamoyl)-2-nitrobenzenecarboximidate (PubChem CID 70440781) has the molecular formula C18H13F3N4O5 and a molecular weight of 422.32 g/mol. Its IUPAC name is methyl 5-[2-cyano-4-(trifluoromethyl)phenoxy]-N-(methylcarbamoyl)-2-nitrobenzenecarboximidate.
| Compound Name | methyl 5-[2-cyano-4-(trifluoromethyl)phenoxy]-N-(methylcarbamoyl)-2-nitrobenzenecarboximidate |
|---|---|
| PubChem CID | 70440781 |
| Molecular Formula | C18H13F3N4O5 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | methyl 5-[2-cyano-4-(trifluoromethyl)phenoxy]-N-(methylcarbamoyl)-2-nitrobenzenecarboximidate |
| SMILES | CNC(=O)N=C(OC)c1cc(Oc2ccc(C(F)(F)F)cc2C#N)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H13F3N4O5/c1-23-17(26)24-16(29-2)13-8-12(4-5-14(13)25(27)28)30-15-6-3-11(18(19,20)21)7-10(15)9-22/h3-8H,1-2H3,(H,23,26) |
| InChIKey | NEHFOBGPSAMUJS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|