C16H11ClF3N2O4P — CID 54509361
2-[3-[chloro(ethyl)phosphoryl]-4-nitrophenoxy]-5-(trifluoromethyl)benzonitrile (PubChem CID 54509361) has the molecular formula C16H11ClF3N2O4P and a molecular weight of 418.70 g/mol. Its IUPAC name is 2-[3-[chloro(ethyl)phosphoryl]-4-nitrophenoxy]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[3-[chloro(ethyl)phosphoryl]-4-nitrophenoxy]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 54509361 |
| Molecular Formula | C16H11ClF3N2O4P |
| Molecular Weight | 418.70 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 2-[3-[chloro(ethyl)phosphoryl]-4-nitrophenoxy]-5-(trifluoromethyl)benzonitrile |
| SMILES | CCP(=O)(Cl)c1cc(Oc2ccc(C(F)(F)F)cc2C#N)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H11ClF3N2O4P/c1-2-27(17,25)15-8-12(4-5-13(15)22(23)24)26-14-6-3-11(16(18,19)20)7-10(14)9-21/h3-8H,2H2,1H3 |
| InChIKey | YIAFXGJCGZJCFU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 93.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|