C17H17ClF3N3O3 — CID 12851507
1-butyl-2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]hydrazine (PubChem CID 12851507) has the molecular formula C17H17ClF3N3O3 and a molecular weight of 403.79 g/mol. Its IUPAC name is 1-butyl-2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]hydrazine.
| Compound Name | 1-butyl-2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]hydrazine |
|---|---|
| PubChem CID | 12851507 |
| Molecular Formula | C17H17ClF3N3O3 |
| Molecular Weight | 403.79 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 1-butyl-2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]hydrazine |
| SMILES | CCCCNNc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17ClF3N3O3/c1-2-3-8-22-23-14-10-12(5-6-15(14)24(25)26)27-16-7-4-11(9-13(16)18)17(19,20)21/h4-7,9-10,22-23H,2-3,8H2,1H3 |
| InChIKey | PAYQSLRRNORECQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.79 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|