C17H17ClF3IN2O3 — CID 13239692
[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]methyl-trimethylazanium iodide (PubChem CID 13239692) has the molecular formula C17H17ClF3IN2O3 and a molecular weight of 516.69 g/mol. Its IUPAC name is [5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]methyl-trimethylazanium iodide.
| Compound Name | [5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]methyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 13239692 |
| Molecular Formula | C17H17ClF3IN2O3 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 515.99 |
| IUPAC Name | [5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]methyl-trimethylazanium iodide |
| SMILES | C[N+](C)(C)Cc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-].[I-] |
| InChI | InChI=1S/C17H17ClF3N2O3.HI/c1-23(2,3)10-11-8-13(5-6-15(11)22(24)25)26-16-7-4-12(9-14(16)18)17(19,20)21;/h4-9H,10H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | GNECSLVNOJUUJO-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|