C16H11ClF3NO7S — CID 13090722
2-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]methylsulfonyl]acetic acid (PubChem CID 13090722) has the molecular formula C16H11ClF3NO7S and a molecular weight of 453.78 g/mol. Its IUPAC name is 2-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]methylsulfonyl]acetic acid.
| Compound Name | 2-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]methylsulfonyl]acetic acid |
|---|---|
| PubChem CID | 13090722 |
| Molecular Formula | C16H11ClF3NO7S |
| Molecular Weight | 453.78 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | 2-[[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]methylsulfonyl]acetic acid |
| SMILES | O=C(O)CS(=O)(=O)Cc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H11ClF3NO7S/c17-12-6-10(16(18,19)20)1-4-14(12)28-11-2-3-13(21(24)25)9(5-11)7-29(26,27)8-15(22)23/h1-6H,7-8H2,(H,22,23) |
| InChIKey | ASMUCCYAIAOWAA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.78 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|