C17H12Cl2F3NO4S — CID 88622484
O-(2-chloroethyl) 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]ethanethioate (PubChem CID 88622484) has the molecular formula C17H12Cl2F3NO4S and a molecular weight of 454.25 g/mol. Its IUPAC name is O-(2-chloroethyl) 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]ethanethioate.
| Compound Name | O-(2-chloroethyl) 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]ethanethioate |
|---|---|
| PubChem CID | 88622484 |
| Molecular Formula | C17H12Cl2F3NO4S |
| Molecular Weight | 454.25 g/mol |
| Exact Mass | 452.98 |
| IUPAC Name | O-(2-chloroethyl) 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]ethanethioate |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(C(F)(F)F)cc2Cl)cc1CC(=S)OCCCl |
| InChI | InChI=1S/C17H12Cl2F3NO4S/c18-5-6-26-16(28)8-10-7-12(2-3-14(10)23(24)25)27-15-4-1-11(9-13(15)19)17(20,21)22/h1-4,7,9H,5-6,8H2 |
| InChIKey | SLIKZXUBODLKHM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.25 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|