C18H16ClF3N2O6 — CID 86740181
methyl 2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]ethoxyamino]acetate (PubChem CID 86740181) has the molecular formula C18H16ClF3N2O6 and a molecular weight of 448.78 g/mol. Its IUPAC name is methyl 2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]ethoxyamino]acetate.
| Compound Name | methyl 2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]ethoxyamino]acetate |
|---|---|
| PubChem CID | 86740181 |
| Molecular Formula | C18H16ClF3N2O6 |
| Molecular Weight | 448.78 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | methyl 2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]ethoxyamino]acetate |
| SMILES | COC(=O)CNOCCc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16ClF3N2O6/c1-28-17(25)10-23-29-7-6-11-8-13(3-4-15(11)24(26)27)30-16-5-2-12(9-14(16)19)18(20,21)22/h2-5,8-9,23H,6-7,10H2,1H3 |
| InChIKey | MPEBGHYEXWSBGN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.78 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|