C15H9ClF3NNaO6S+ — CID 70539959
sodium [5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]sulfanyl 2-hydroxyacetate (PubChem CID 70539959) has the molecular formula C15H9ClF3NNaO6S+ and a molecular weight of 446.74 g/mol. Its IUPAC name is sodium [5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]sulfanyl 2-hydroxyacetate.
| Compound Name | sodium [5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]sulfanyl 2-hydroxyacetate |
|---|---|
| PubChem CID | 70539959 |
| Molecular Formula | C15H9ClF3NNaO6S+ |
| Molecular Weight | 446.74 g/mol |
| Exact Mass | 445.97 |
| IUPAC Name | sodium [5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]sulfanyl 2-hydroxyacetate |
| SMILES | O=C(CO)OSc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-].[Na+] |
| InChI | InChI=1S/C15H9ClF3NO6S.Na/c16-10-5-8(15(17,18)19)1-4-12(10)25-9-2-3-11(20(23)24)13(6-9)27-26-14(22)7-21;/h1-6,21H,7H2;/q;+1 |
| InChIKey | GEGHWQMHEYVHIV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.74 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|