C18H15ClF3NO6S — CID 70512202
2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]ethylsulfanyl]propanoic acid (PubChem CID 70512202) has the molecular formula C18H15ClF3NO6S and a molecular weight of 465.83 g/mol. Its IUPAC name is 2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]ethylsulfanyl]propanoic acid.
| Compound Name | 2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]ethylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 70512202 |
| Molecular Formula | C18H15ClF3NO6S |
| Molecular Weight | 465.83 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | 2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]ethylsulfanyl]propanoic acid |
| SMILES | CC(SCCOc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C18H15ClF3NO6S/c1-10(17(24)25)30-7-6-28-16-9-12(3-4-14(16)23(26)27)29-15-5-2-11(8-13(15)19)18(20,21)22/h2-5,8-10H,6-7H2,1H3,(H,24,25) |
| InChIKey | JPOWJJRXCSPLPA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.83 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|