C15H12ClF3NO7P — CID 173430513
[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]methyl-methoxyphosphinic acid (PubChem CID 173430513) has the molecular formula C15H12ClF3NO7P and a molecular weight of 441.68 g/mol. Its IUPAC name is [5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]methyl-methoxyphosphinic acid.
| Compound Name | [5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]methyl-methoxyphosphinic acid |
|---|---|
| PubChem CID | 173430513 |
| Molecular Formula | C15H12ClF3NO7P |
| Molecular Weight | 441.68 g/mol |
| Exact Mass | 441.00 |
| IUPAC Name | [5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]methyl-methoxyphosphinic acid |
| SMILES | COP(=O)(O)COc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12ClF3NO7P/c1-25-28(23,24)8-26-14-7-10(3-4-12(14)20(21)22)27-13-5-2-9(6-11(13)16)15(17,18)19/h2-7H,8H2,1H3,(H,23,24) |
| InChIKey | CMJKTUCSFGVIGF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.68 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|