C19H17ClF3NO6S — CID 20554021
methyl 2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]ethylsulfanyl]propanoate (PubChem CID 20554021) has the molecular formula C19H17ClF3NO6S and a molecular weight of 479.86 g/mol. Its IUPAC name is methyl 2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]ethylsulfanyl]propanoate.
| Compound Name | methyl 2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]ethylsulfanyl]propanoate |
|---|---|
| PubChem CID | 20554021 |
| Molecular Formula | C19H17ClF3NO6S |
| Molecular Weight | 479.86 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | methyl 2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]ethylsulfanyl]propanoate |
| SMILES | COC(=O)C(C)SCCOc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17ClF3NO6S/c1-11(18(25)28-2)31-8-7-29-17-10-13(4-5-15(17)24(26)27)30-16-6-3-12(9-14(16)20)19(21,22)23/h3-6,9-11H,7-8H2,1-2H3 |
| InChIKey | KKTPNAWPRDDDHB-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.86 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|