C20H17ClF3NO7 — CID 70381962
2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-4-ethoxy-3-methyl-4-oxobutanoic acid (PubChem CID 70381962) has the molecular formula C20H17ClF3NO7 and a molecular weight of 475.80 g/mol. Its IUPAC name is 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-4-ethoxy-3-methyl-4-oxobutanoic acid.
| Compound Name | 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-4-ethoxy-3-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 70381962 |
| Molecular Formula | C20H17ClF3NO7 |
| Molecular Weight | 475.80 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-4-ethoxy-3-methyl-4-oxobutanoic acid |
| SMILES | CCOC(=O)C(C)C(C(=O)O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17ClF3NO7/c1-3-31-19(28)10(2)17(18(26)27)13-9-12(5-6-15(13)25(29)30)32-16-7-4-11(8-14(16)21)20(22,23)24/h4-10,17H,3H2,1-2H3,(H,26,27) |
| InChIKey | UFTQDNPTUPDWDX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.80 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|