C18H16ClF3N2O5 — CID 70372413
4-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]-2-methylbutanoic acid (PubChem CID 70372413) has the molecular formula C18H16ClF3N2O5 and a molecular weight of 432.78 g/mol. Its IUPAC name is 4-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]-2-methylbutanoic acid.
| Compound Name | 4-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 70372413 |
| Molecular Formula | C18H16ClF3N2O5 |
| Molecular Weight | 432.78 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 4-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]-2-methylbutanoic acid |
| SMILES | CC(CCNc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C18H16ClF3N2O5/c1-10(17(25)26)6-7-23-14-9-12(3-4-15(14)24(27)28)29-16-5-2-11(8-13(16)19)18(20,21)22/h2-5,8-10,23H,6-7H2,1H3,(H,25,26) |
| InChIKey | BTJLWWWCVPZEBA-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.78 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|