C18H16ClF3N2O7 — CID 57116608
2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]-1-methoxyethoxy]acetic acid (PubChem CID 57116608) has the molecular formula C18H16ClF3N2O7 and a molecular weight of 464.78 g/mol. Its IUPAC name is 2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]-1-methoxyethoxy]acetic acid.
| Compound Name | 2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]-1-methoxyethoxy]acetic acid |
|---|---|
| PubChem CID | 57116608 |
| Molecular Formula | C18H16ClF3N2O7 |
| Molecular Weight | 464.78 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 2-[2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]-1-methoxyethoxy]acetic acid |
| SMILES | COC(CNc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])OCC(=O)O |
| InChI | InChI=1S/C18H16ClF3N2O7/c1-29-17(30-9-16(25)26)8-23-13-7-11(3-4-14(13)24(27)28)31-15-5-2-10(6-12(15)19)18(20,21)22/h2-7,17,23H,8-9H2,1H3,(H,25,26) |
| InChIKey | JOTSZVNOYCAGBH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.78 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|